C9H22NO3- — CID 19101833
N,N-diethylethanamine;methanol;acetate (PubChem CID 19101833) has the molecular formula C9H22NO3- and a molecular weight of 192.28 g/mol. Its IUPAC name is N,N-diethylethanamine;methanol;acetate.
| Compound Name | N,N-diethylethanamine;methanol;acetate |
|---|---|
| PubChem CID | 19101833 |
| Molecular Formula | C9H22NO3- |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N,N-diethylethanamine;methanol;acetate |
| SMILES | CC(=O)[O-].CCN(CC)CC.CO |
| InChI | InChI=1S/C6H15N.C2H4O2.CH4O/c1-4-7(5-2)6-3;1-2(3)4;1-2/h4-6H2,1-3H3;1H3,(H,3,4);2H,1H3/p-1 |
| InChIKey | APYDIYHMJJUSAT-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |