About potassium;methanol;acetate
potassium;methanol;acetate (PubChem CID 87290228) has the molecular formula C3H7KO3
and a molecular weight of 130.18 g/mol. Its IUPAC name is potassium;methanol;acetate.
Molecular Properties
| Compound Name | potassium;methanol;acetate |
| PubChem CID | 87290228 |
| Molecular Formula | C3H7KO3 |
| Molecular Weight | 130.18 g/mol |
| Exact Mass | 130.00 |
| IUPAC Name | potassium;methanol;acetate |
| SMILES | CC(=O)[O-].CO.[K+] |
| InChI | InChI=1S/C2H4O2.CH4O.K/c1-2(3)4;1-2;/h1H3,(H,3,4);2H,1H3;/q;;+1/p-1 |
| InChIKey | HCLGAQLMEOAUGE-UHFFFAOYSA-M |
| XLogP | -4.63 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.18 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;methanol;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;methanol;acetate?
The IUPAC name of potassium;methanol;acetate (CID 87290228) is potassium;methanol;acetate.
What is the SMILES notation for potassium;methanol;acetate?
The canonical SMILES for potassium;methanol;acetate is CC(=O)[O-].CO.[K+].
What is the InChIKey of potassium;methanol;acetate?
The InChIKey is HCLGAQLMEOAUGE-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.CH4O.K/c1-2(3)4;1-2;/h1H3,(H,3,4);2H,1H3;/q;;+1/p-1.
What are the key properties of potassium;methanol;acetate?
potassium;methanol;acetate has a molecular weight of 130.18 g/mol, XLogP of -4.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;methanol;acetate is sourced from PubChem (CID 87290228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).