About CID 170997571
CID 170997571 (PubChem CID 170997571) has the molecular formula C4H6MnO4-2
and a molecular weight of 173.03 g/mol.
Molecular Properties
| Compound Name | CID 170997571 |
| PubChem CID | 170997571 |
| Molecular Formula | C4H6MnO4-2 |
| Molecular Weight | 173.03 g/mol |
| Exact Mass | 172.97 |
| IUPAC Name | — |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Mn] |
| InChI | InChI=1S/2C2H4O2.Mn/c2*1-2(3)4;/h2*1H3,(H,3,4);/p-2 |
| InChIKey | VQWQYXBWRCCZGX-UHFFFAOYSA-L |
| XLogP | -2.49 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.03 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 170997571 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170997571?
The IUPAC name of CID 170997571 (CID 170997571) is not available.
What is the SMILES notation for CID 170997571?
The canonical SMILES for CID 170997571 is CC(=O)[O-].CC(=O)[O-].[Mn].
What is the InChIKey of CID 170997571?
The InChIKey is VQWQYXBWRCCZGX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H4O2.Mn/c2*1-2(3)4;/h2*1H3,(H,3,4);/p-2.
What are the key properties of CID 170997571?
CID 170997571 has a molecular weight of 173.03 g/mol, XLogP of -2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170997571 is sourced from PubChem (CID 170997571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).