About manganese(3+) diacetate
manganese(3+) diacetate (PubChem CID 159209977) has the molecular formula C4H6MnO4+
and a molecular weight of 173.03 g/mol. Its IUPAC name is manganese(3+) diacetate.
Molecular Properties
| Compound Name | manganese(3+) diacetate |
| PubChem CID | 159209977 |
| Molecular Formula | C4H6MnO4+ |
| Molecular Weight | 173.03 g/mol |
| Exact Mass | 172.96 |
| IUPAC Name | manganese(3+) diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Mn+3] |
| InChI | InChI=1S/2C2H4O2.Mn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+3/p-2 |
| InChIKey | KQJIKZZYDFLGGS-UHFFFAOYSA-L |
| XLogP | -2.49 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.03 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze manganese(3+) diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(3+) diacetate?
The IUPAC name of manganese(3+) diacetate (CID 159209977) is manganese(3+) diacetate.
What is the SMILES notation for manganese(3+) diacetate?
The canonical SMILES for manganese(3+) diacetate is CC(=O)[O-].CC(=O)[O-].[Mn+3].
What is the InChIKey of manganese(3+) diacetate?
The InChIKey is KQJIKZZYDFLGGS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H4O2.Mn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+3/p-2.
What are the key properties of manganese(3+) diacetate?
manganese(3+) diacetate has a molecular weight of 173.03 g/mol, XLogP of -2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(3+) diacetate is sourced from PubChem (CID 159209977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).