About terbium(3+) acetate
terbium(3+) acetate (PubChem CID 22482914) has the molecular formula C2H3O2Tb+2
and a molecular weight of 217.97 g/mol. Its IUPAC name is terbium(3+) acetate.
Molecular Properties
| Compound Name | terbium(3+) acetate |
| PubChem CID | 22482914 |
| Molecular Formula | C2H3O2Tb+2 |
| Molecular Weight | 217.97 g/mol |
| Exact Mass | 217.94 |
| IUPAC Name | terbium(3+) acetate |
| SMILES | CC(=O)[O-].[Tb+3] |
| InChI | InChI=1S/C2H4O2.Tb/c1-2(3)4;/h1H3,(H,3,4);/q;+3/p-1 |
| InChIKey | QQHVSVVETRENQR-UHFFFAOYSA-M |
| XLogP | -1.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.97 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze terbium(3+) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of terbium(3+) acetate?
The IUPAC name of terbium(3+) acetate (CID 22482914) is terbium(3+) acetate.
What is the SMILES notation for terbium(3+) acetate?
The canonical SMILES for terbium(3+) acetate is CC(=O)[O-].[Tb+3].
What is the InChIKey of terbium(3+) acetate?
The InChIKey is QQHVSVVETRENQR-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Tb/c1-2(3)4;/h1H3,(H,3,4);/q;+3/p-1.
What are the key properties of terbium(3+) acetate?
terbium(3+) acetate has a molecular weight of 217.97 g/mol, XLogP of -1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for terbium(3+) acetate is sourced from PubChem (CID 22482914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).