About CID 87243144
CID 87243144 (PubChem CID 87243144) has the molecular formula C4H6BiO4
and a molecular weight of 327.07 g/mol.
Molecular Properties
| Compound Name | CID 87243144 |
| PubChem CID | 87243144 |
| Molecular Formula | C4H6BiO4 |
| Molecular Weight | 327.07 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | — |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Bi+2] |
| InChI | InChI=1S/2C2H4O2.Bi/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | RWMLVMBSSADKRA-UHFFFAOYSA-L |
| XLogP | -2.87 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.07 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 87243144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87243144?
The IUPAC name of CID 87243144 (CID 87243144) is not available.
What is the SMILES notation for CID 87243144?
The canonical SMILES for CID 87243144 is CC(=O)[O-].CC(=O)[O-].[Bi+2].
What is the InChIKey of CID 87243144?
The InChIKey is RWMLVMBSSADKRA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H4O2.Bi/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2.
What are the key properties of CID 87243144?
CID 87243144 has a molecular weight of 327.07 g/mol, XLogP of -2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87243144 is sourced from PubChem (CID 87243144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).