About N,N-diethylethanamine;ethane
N,N-diethylethanamine;ethane (PubChem CID 22114990) has the molecular formula C8H21N
and a molecular weight of 131.26 g/mol. Its IUPAC name is N,N-diethylethanamine;ethane.
Molecular Properties
| Compound Name | N,N-diethylethanamine;ethane |
| PubChem CID | 22114990 |
| Molecular Formula | C8H21N |
| Molecular Weight | 131.26 g/mol |
| Exact Mass | 131.17 |
| IUPAC Name | N,N-diethylethanamine;ethane |
| SMILES | CC.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C2H6/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;1-2H3 |
| InChIKey | HZSWFESKPQSRJG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;ethane?
The IUPAC name of N,N-diethylethanamine;ethane (CID 22114990) is N,N-diethylethanamine;ethane.
What is the SMILES notation for N,N-diethylethanamine;ethane?
The canonical SMILES for N,N-diethylethanamine;ethane is CC.CCN(CC)CC.
What is the InChIKey of N,N-diethylethanamine;ethane?
The InChIKey is HZSWFESKPQSRJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H6/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;1-2H3.
What are the key properties of N,N-diethylethanamine;ethane?
N,N-diethylethanamine;ethane has a molecular weight of 131.26 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;ethane is sourced from PubChem (CID 22114990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).