N,N-diethylethanamine chloride

C6H15ClN- — CID 22292735

IUPACN,N-diethylethanamine chloride
SMILESCCN(CC)CC.[Cl-]
InChIInChI=1S/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H/p-1
InChIKeyILWRPSCZWQJDMK-UHFFFAOYSA-M
MW136.65 g/mol
LogP-1.65
Rot. Bonds3

About N,N-diethylethanamine chloride

N,N-diethylethanamine chloride (PubChem CID 22292735) has the molecular formula C6H15ClN- and a molecular weight of 136.65 g/mol. Its IUPAC name is N,N-diethylethanamine chloride.

Molecular Properties

Compound NameN,N-diethylethanamine chloride
PubChem CID22292735
Molecular FormulaC6H15ClN-
Molecular Weight136.65 g/mol
Exact Mass136.09
IUPAC NameN,N-diethylethanamine chloride
SMILESCCN(CC)CC.[Cl-]
InChIInChI=1S/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H/p-1
InChIKeyILWRPSCZWQJDMK-UHFFFAOYSA-M
XLogP-1.65
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500136.65
LogP ≤ 5-1.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze N,N-diethylethanamine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethylethanamine chloride?
The IUPAC name of N,N-diethylethanamine chloride (CID 22292735) is N,N-diethylethanamine chloride.
What is the SMILES notation for N,N-diethylethanamine chloride?
The canonical SMILES for N,N-diethylethanamine chloride is CCN(CC)CC.[Cl-].
What is the InChIKey of N,N-diethylethanamine chloride?
The InChIKey is ILWRPSCZWQJDMK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H/p-1.
What are the key properties of N,N-diethylethanamine chloride?
N,N-diethylethanamine chloride has a molecular weight of 136.65 g/mol, XLogP of -1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine chloride is sourced from PubChem (CID 22292735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).