About N,N-diethylethanamine;neodymium(3+);trichloride
N,N-diethylethanamine;neodymium(3+);trichloride (PubChem CID 173208753) has the molecular formula C6H15Cl3NNd
and a molecular weight of 351.79 g/mol. Its IUPAC name is N,N-diethylethanamine;neodymium(3+);trichloride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;neodymium(3+);trichloride |
| PubChem CID | 173208753 |
| Molecular Formula | C6H15Cl3NNd |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | N,N-diethylethanamine;neodymium(3+);trichloride |
| SMILES | CCN(CC)CC.[Cl-].[Cl-].[Cl-].[Nd+3] |
| InChI | InChI=1S/C6H15N.3ClH.Nd/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | DULHRAISQRWLNQ-UHFFFAOYSA-K |
| XLogP | -7.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | -7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylethanamine;neodymium(3+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;neodymium(3+);trichloride?
The IUPAC name of N,N-diethylethanamine;neodymium(3+);trichloride (CID 173208753) is N,N-diethylethanamine;neodymium(3+);trichloride.
What is the SMILES notation for N,N-diethylethanamine;neodymium(3+);trichloride?
The canonical SMILES for N,N-diethylethanamine;neodymium(3+);trichloride is CCN(CC)CC.[Cl-].[Cl-].[Cl-].[Nd+3].
What is the InChIKey of N,N-diethylethanamine;neodymium(3+);trichloride?
The InChIKey is DULHRAISQRWLNQ-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H15N.3ClH.Nd/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;3*1H;/q;;;;+3/p-3.
What are the key properties of N,N-diethylethanamine;neodymium(3+);trichloride?
N,N-diethylethanamine;neodymium(3+);trichloride has a molecular weight of 351.79 g/mol, XLogP of -7.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;neodymium(3+);trichloride is sourced from PubChem (CID 173208753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).