About chromium(6+);N,N-diethylethanamine;tris(oxygen(2-))
chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)) (PubChem CID 159031858) has the molecular formula C6H15CrNO3
and a molecular weight of 201.19 g/mol. Its IUPAC name is chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)).
Molecular Properties
| Compound Name | chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)) |
| PubChem CID | 159031858 |
| Molecular Formula | C6H15CrNO3 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)) |
| SMILES | CCN(CC)CC.[Cr+6].[O-2].[O-2].[O-2] |
| InChI | InChI=1S/C6H15N.Cr.3O/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;;;;/q;+6;3*-2 |
| InChIKey | JUZFFXHDGLAPET-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(6+);N,N-diethylethanamine;tris(oxygen(2-))?
The IUPAC name of chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)) (CID 159031858) is chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)).
What is the SMILES notation for chromium(6+);N,N-diethylethanamine;tris(oxygen(2-))?
The canonical SMILES for chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)) is CCN(CC)CC.[Cr+6].[O-2].[O-2].[O-2].
What is the InChIKey of chromium(6+);N,N-diethylethanamine;tris(oxygen(2-))?
The InChIKey is JUZFFXHDGLAPET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.Cr.3O/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;;;;/q;+6;3*-2.
What are the key properties of chromium(6+);N,N-diethylethanamine;tris(oxygen(2-))?
chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)) has a molecular weight of 201.19 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(6+);N,N-diethylethanamine;tris(oxygen(2-)) is sourced from PubChem (CID 159031858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).