About N,N-diethylethanamine;palladium(2+)
N,N-diethylethanamine;palladium(2+) (PubChem CID 22219787) has the molecular formula C6H15NPd+2
and a molecular weight of 207.61 g/mol. Its IUPAC name is N,N-diethylethanamine;palladium(2+).
Molecular Properties
| Compound Name | N,N-diethylethanamine;palladium(2+) |
| PubChem CID | 22219787 |
| Molecular Formula | C6H15NPd+2 |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | N,N-diethylethanamine;palladium(2+) |
| SMILES | CCN(CC)CC.[Pd+2] |
| InChI | InChI=1S/C6H15N.Pd/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;+2 |
| InChIKey | WHVRBLNNENNLAW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylethanamine;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;palladium(2+)?
The IUPAC name of N,N-diethylethanamine;palladium(2+) (CID 22219787) is N,N-diethylethanamine;palladium(2+).
What is the SMILES notation for N,N-diethylethanamine;palladium(2+)?
The canonical SMILES for N,N-diethylethanamine;palladium(2+) is CCN(CC)CC.[Pd+2].
What is the InChIKey of N,N-diethylethanamine;palladium(2+)?
The InChIKey is WHVRBLNNENNLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.Pd/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;+2.
What are the key properties of N,N-diethylethanamine;palladium(2+)?
N,N-diethylethanamine;palladium(2+) has a molecular weight of 207.61 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;palladium(2+) is sourced from PubChem (CID 22219787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).