About aluminum;N,N-diethylethanamine;trichloride
aluminum;N,N-diethylethanamine;trichloride (PubChem CID 86649339) has the molecular formula C6H15AlCl3N
and a molecular weight of 234.53 g/mol. Its IUPAC name is aluminum;N,N-diethylethanamine;trichloride.
Molecular Properties
| Compound Name | aluminum;N,N-diethylethanamine;trichloride |
| PubChem CID | 86649339 |
| Molecular Formula | C6H15AlCl3N |
| Molecular Weight | 234.53 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | aluminum;N,N-diethylethanamine;trichloride |
| SMILES | CCN(CC)CC.[Al+3].[Cl-].[Cl-].[Cl-] |
| InChI | InChI=1S/C6H15N.Al.3ClH/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | VNICJHGMMYPVLC-UHFFFAOYSA-K |
| XLogP | -8.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.53 |
| LogP ≤ 5 | -8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze aluminum;N,N-diethylethanamine;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;N,N-diethylethanamine;trichloride?
The IUPAC name of aluminum;N,N-diethylethanamine;trichloride (CID 86649339) is aluminum;N,N-diethylethanamine;trichloride.
What is the SMILES notation for aluminum;N,N-diethylethanamine;trichloride?
The canonical SMILES for aluminum;N,N-diethylethanamine;trichloride is CCN(CC)CC.[Al+3].[Cl-].[Cl-].[Cl-].
What is the InChIKey of aluminum;N,N-diethylethanamine;trichloride?
The InChIKey is VNICJHGMMYPVLC-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H15N.Al.3ClH/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;;3*1H/q;+3;;;/p-3.
What are the key properties of aluminum;N,N-diethylethanamine;trichloride?
aluminum;N,N-diethylethanamine;trichloride has a molecular weight of 234.53 g/mol, XLogP of -8.02, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;N,N-diethylethanamine;trichloride is sourced from PubChem (CID 86649339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).