About zinc;N,N-diethylethanamine;chloride
zinc;N,N-diethylethanamine;chloride (PubChem CID 19867119) has the molecular formula C6H15ClNZn+
and a molecular weight of 202.04 g/mol. Its IUPAC name is zinc;N,N-diethylethanamine;chloride.
Molecular Properties
| Compound Name | zinc;N,N-diethylethanamine;chloride |
| PubChem CID | 19867119 |
| Molecular Formula | C6H15ClNZn+ |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | zinc;N,N-diethylethanamine;chloride |
| SMILES | CCN(CC)CC.[Cl-].[Zn+2] |
| InChI | InChI=1S/C6H15N.ClH.Zn/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;1H;/q;;+2/p-1 |
| InChIKey | BFIMRBXNOCNCNQ-UHFFFAOYSA-M |
| XLogP | -1.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;N,N-diethylethanamine;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;N,N-diethylethanamine;chloride?
The IUPAC name of zinc;N,N-diethylethanamine;chloride (CID 19867119) is zinc;N,N-diethylethanamine;chloride.
What is the SMILES notation for zinc;N,N-diethylethanamine;chloride?
The canonical SMILES for zinc;N,N-diethylethanamine;chloride is CCN(CC)CC.[Cl-].[Zn+2].
What is the InChIKey of zinc;N,N-diethylethanamine;chloride?
The InChIKey is BFIMRBXNOCNCNQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15N.ClH.Zn/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;1H;/q;;+2/p-1.
What are the key properties of zinc;N,N-diethylethanamine;chloride?
zinc;N,N-diethylethanamine;chloride has a molecular weight of 202.04 g/mol, XLogP of -1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;N,N-diethylethanamine;chloride is sourced from PubChem (CID 19867119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).