About N,N-diethylethanamine;hydrate;trihydrofluoride
N,N-diethylethanamine;hydrate;trihydrofluoride (PubChem CID 172684956) has the molecular formula C6H20F3NO
and a molecular weight of 179.23 g/mol. Its IUPAC name is N,N-diethylethanamine;hydrate;trihydrofluoride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;hydrate;trihydrofluoride |
| PubChem CID | 172684956 |
| Molecular Formula | C6H20F3NO |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | N,N-diethylethanamine;hydrate;trihydrofluoride |
| SMILES | CCN(CC)CC.F.F.F.O |
| InChI | InChI=1S/C6H15N.3FH.H2O/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;3*1H;1H2 |
| InChIKey | AXGDZUVZUKLKMI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylethanamine;hydrate;trihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;hydrate;trihydrofluoride?
The IUPAC name of N,N-diethylethanamine;hydrate;trihydrofluoride (CID 172684956) is N,N-diethylethanamine;hydrate;trihydrofluoride.
What is the SMILES notation for N,N-diethylethanamine;hydrate;trihydrofluoride?
The canonical SMILES for N,N-diethylethanamine;hydrate;trihydrofluoride is CCN(CC)CC.F.F.F.O.
What is the InChIKey of N,N-diethylethanamine;hydrate;trihydrofluoride?
The InChIKey is AXGDZUVZUKLKMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.3FH.H2O/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;3*1H;1H2.
What are the key properties of N,N-diethylethanamine;hydrate;trihydrofluoride?
N,N-diethylethanamine;hydrate;trihydrofluoride has a molecular weight of 179.23 g/mol, XLogP of 0.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;hydrate;trihydrofluoride is sourced from PubChem (CID 172684956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).