About lithium;N,N-diethylethanamine;hydride
lithium;N,N-diethylethanamine;hydride (PubChem CID 161206277) has the molecular formula C6H16LiN
and a molecular weight of 109.14 g/mol. Its IUPAC name is lithium;N,N-diethylethanamine;hydride.
Molecular Properties
| Compound Name | lithium;N,N-diethylethanamine;hydride |
| PubChem CID | 161206277 |
| Molecular Formula | C6H16LiN |
| Molecular Weight | 109.14 g/mol |
| Exact Mass | 109.14 |
| IUPAC Name | lithium;N,N-diethylethanamine;hydride |
| SMILES | CCN(CC)CC.[H-].[Li+] |
| InChI | InChI=1S/C6H15N.Li.H/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;;/q;+1;-1 |
| InChIKey | UVQFLINLQTWECE-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.14 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;N,N-diethylethanamine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;N,N-diethylethanamine;hydride?
The IUPAC name of lithium;N,N-diethylethanamine;hydride (CID 161206277) is lithium;N,N-diethylethanamine;hydride.
What is the SMILES notation for lithium;N,N-diethylethanamine;hydride?
The canonical SMILES for lithium;N,N-diethylethanamine;hydride is CCN(CC)CC.[H-].[Li+].
What is the InChIKey of lithium;N,N-diethylethanamine;hydride?
The InChIKey is UVQFLINLQTWECE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.Li.H/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;;/q;+1;-1.
What are the key properties of lithium;N,N-diethylethanamine;hydride?
lithium;N,N-diethylethanamine;hydride has a molecular weight of 109.14 g/mol, XLogP of -1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;N,N-diethylethanamine;hydride is sourced from PubChem (CID 161206277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).