C8H21Cl2NO2 — CID 173065244
acetic acid;N,N-diethylethanamine;dihydrochloride (PubChem CID 173065244) has the molecular formula C8H21Cl2NO2 and a molecular weight of 234.17 g/mol. Its IUPAC name is acetic acid;N,N-diethylethanamine;dihydrochloride.
| Compound Name | acetic acid;N,N-diethylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 173065244 |
| Molecular Formula | C8H21Cl2NO2 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | acetic acid;N,N-diethylethanamine;dihydrochloride |
| SMILES | CC(=O)O.CCN(CC)CC.Cl.Cl |
| InChI | InChI=1S/C6H15N.C2H4O2.2ClH/c1-4-7(5-2)6-3;1-2(3)4;;/h4-6H2,1-3H3;1H3,(H,3,4);2*1H |
| InChIKey | MEJMKQLFCODYPX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |