About N,N-diethylethanamine;zinc;dihydrochloride
N,N-diethylethanamine;zinc;dihydrochloride (PubChem CID 175296051) has the molecular formula C6H17Cl2NZn
and a molecular weight of 239.50 g/mol. Its IUPAC name is N,N-diethylethanamine;zinc;dihydrochloride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;zinc;dihydrochloride |
| PubChem CID | 175296051 |
| Molecular Formula | C6H17Cl2NZn |
| Molecular Weight | 239.50 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | N,N-diethylethanamine;zinc;dihydrochloride |
| SMILES | CCN(CC)CC.Cl.Cl.[Zn] |
| InChI | InChI=1S/C6H15N.2ClH.Zn/c1-4-7(5-2)6-3;;;/h4-6H2,1-3H3;2*1H; |
| InChIKey | BCELTQCHFKGHGA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;zinc;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;zinc;dihydrochloride?
The IUPAC name of N,N-diethylethanamine;zinc;dihydrochloride (CID 175296051) is N,N-diethylethanamine;zinc;dihydrochloride.
What is the SMILES notation for N,N-diethylethanamine;zinc;dihydrochloride?
The canonical SMILES for N,N-diethylethanamine;zinc;dihydrochloride is CCN(CC)CC.Cl.Cl.[Zn].
What is the InChIKey of N,N-diethylethanamine;zinc;dihydrochloride?
The InChIKey is BCELTQCHFKGHGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.2ClH.Zn/c1-4-7(5-2)6-3;;;/h4-6H2,1-3H3;2*1H;.
What are the key properties of N,N-diethylethanamine;zinc;dihydrochloride?
N,N-diethylethanamine;zinc;dihydrochloride has a molecular weight of 239.50 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;zinc;dihydrochloride is sourced from PubChem (CID 175296051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).