About benzene;N,N-diethylethanamine;hydrochloride
benzene;N,N-diethylethanamine;hydrochloride (PubChem CID 173044195) has the molecular formula C12H22ClN
and a molecular weight of 215.77 g/mol. Its IUPAC name is benzene;N,N-diethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | benzene;N,N-diethylethanamine;hydrochloride |
| PubChem CID | 173044195 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | benzene;N,N-diethylethanamine;hydrochloride |
| SMILES | CCN(CC)CC.Cl.c1ccccc1 |
| InChI | InChI=1S/C6H15N.C6H6.ClH/c1-4-7(5-2)6-3;1-2-4-6-5-3-1;/h4-6H2,1-3H3;1-6H;1H |
| InChIKey | JXWIWFIIDWHZHE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;N,N-diethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N,N-diethylethanamine;hydrochloride?
The IUPAC name of benzene;N,N-diethylethanamine;hydrochloride (CID 173044195) is benzene;N,N-diethylethanamine;hydrochloride.
What is the SMILES notation for benzene;N,N-diethylethanamine;hydrochloride?
The canonical SMILES for benzene;N,N-diethylethanamine;hydrochloride is CCN(CC)CC.Cl.c1ccccc1.
What is the InChIKey of benzene;N,N-diethylethanamine;hydrochloride?
The InChIKey is JXWIWFIIDWHZHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C6H6.ClH/c1-4-7(5-2)6-3;1-2-4-6-5-3-1;/h4-6H2,1-3H3;1-6H;1H.
What are the key properties of benzene;N,N-diethylethanamine;hydrochloride?
benzene;N,N-diethylethanamine;hydrochloride has a molecular weight of 215.77 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N,N-diethylethanamine;hydrochloride is sourced from PubChem (CID 173044195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).