C14H32N2O8 — CID 175226296
acetic acid;N',N'-diethylethane-1,2-diamine (PubChem CID 175226296) has the molecular formula C14H32N2O8 and a molecular weight of 356.42 g/mol. Its IUPAC name is acetic acid;N',N'-diethylethane-1,2-diamine.
| Compound Name | acetic acid;N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 175226296 |
| Molecular Formula | C14H32N2O8 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | acetic acid;N',N'-diethylethane-1,2-diamine |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CCN(CC)CCN |
| InChI | InChI=1S/C6H16N2.4C2H4O2/c1-3-8(4-2)6-5-7;4*1-2(3)4/h3-7H2,1-2H3;4*1H3,(H,3,4) |
| InChIKey | HNRGTIYQUJUVTM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |