acetic acid;N',N'-diethylethane-1,2-diamine

C14H32N2O8 — CID 175226296

IUPACacetic acid;N',N'-diethylethane-1,2-diamine
SMILESCC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CCN(CC)CCN
InChIInChI=1S/C6H16N2.4C2H4O2/c1-3-8(4-2)6-5-7;4*1-2(3)4/h3-7H2,1-2H3;4*1H3,(H,3,4)
InChIKeyHNRGTIYQUJUVTM-UHFFFAOYSA-N
MW356.42 g/mol
LogP0.65
Rot. Bonds4

About acetic acid;N',N'-diethylethane-1,2-diamine

acetic acid;N',N'-diethylethane-1,2-diamine (PubChem CID 175226296) has the molecular formula C14H32N2O8 and a molecular weight of 356.42 g/mol. Its IUPAC name is acetic acid;N',N'-diethylethane-1,2-diamine.

Molecular Properties

Compound Nameacetic acid;N',N'-diethylethane-1,2-diamine
PubChem CID175226296
Molecular FormulaC14H32N2O8
Molecular Weight356.42 g/mol
Exact Mass356.22
IUPAC Nameacetic acid;N',N'-diethylethane-1,2-diamine
SMILESCC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CCN(CC)CCN
InChIInChI=1S/C6H16N2.4C2H4O2/c1-3-8(4-2)6-5-7;4*1-2(3)4/h3-7H2,1-2H3;4*1H3,(H,3,4)
InChIKeyHNRGTIYQUJUVTM-UHFFFAOYSA-N
XLogP0.65
TPSA178.46 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.42
LogP ≤ 50.65
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze acetic acid;N',N'-diethylethane-1,2-diamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;N',N'-diethylethane-1,2-diamine?
The IUPAC name of acetic acid;N',N'-diethylethane-1,2-diamine (CID 175226296) is acetic acid;N',N'-diethylethane-1,2-diamine.
What is the SMILES notation for acetic acid;N',N'-diethylethane-1,2-diamine?
The canonical SMILES for acetic acid;N',N'-diethylethane-1,2-diamine is CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CCN(CC)CCN.
What is the InChIKey of acetic acid;N',N'-diethylethane-1,2-diamine?
The InChIKey is HNRGTIYQUJUVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.4C2H4O2/c1-3-8(4-2)6-5-7;4*1-2(3)4/h3-7H2,1-2H3;4*1H3,(H,3,4).
What are the key properties of acetic acid;N',N'-diethylethane-1,2-diamine?
acetic acid;N',N'-diethylethane-1,2-diamine has a molecular weight of 356.42 g/mol, XLogP of 0.65, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N',N'-diethylethane-1,2-diamine is sourced from PubChem (CID 175226296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).