About CID 172703845
CID 172703845 (PubChem CID 172703845) has the molecular formula C6H16N2NaO
and a molecular weight of 155.20 g/mol.
Molecular Properties
| Compound Name | CID 172703845 |
| PubChem CID | 172703845 |
| Molecular Formula | C6H16N2NaO |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | — |
| SMILES | CCN(CCN)CCO.[Na] |
| InChI | InChI=1S/C6H16N2O.Na/c1-2-8(4-3-7)5-6-9;/h9H,2-7H2,1H3; |
| InChIKey | DHYKGTGUFQKGLB-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 172703845 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172703845?
The IUPAC name of CID 172703845 (CID 172703845) is not available.
What is the SMILES notation for CID 172703845?
The canonical SMILES for CID 172703845 is CCN(CCN)CCO.[Na].
What is the InChIKey of CID 172703845?
The InChIKey is DHYKGTGUFQKGLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O.Na/c1-2-8(4-3-7)5-6-9;/h9H,2-7H2,1H3;.
What are the key properties of CID 172703845?
CID 172703845 has a molecular weight of 155.20 g/mol, XLogP of -1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172703845 is sourced from PubChem (CID 172703845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).