About 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol
2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol (PubChem CID 161297591) has the molecular formula C13H32N2O3
and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol |
| PubChem CID | 161297591 |
| Molecular Formula | C13H32N2O3 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.24 |
| IUPAC Name | 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol |
| SMILES | CCCN(CC)CCO.CCN(CCO)CCO |
| InChI | InChI=1S/C7H17NO.C6H15NO2/c1-3-5-8(4-2)6-7-9;1-2-7(3-5-8)4-6-9/h9H,3-7H2,1-2H3;8-9H,2-6H2,1H3 |
| InChIKey | VHEIPIDRWMJGDT-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol?
The IUPAC name of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol (CID 161297591) is 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol.
What is the SMILES notation for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol?
The canonical SMILES for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol is CCCN(CC)CCO.CCN(CCO)CCO.
What is the InChIKey of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol?
The InChIKey is VHEIPIDRWMJGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO.C6H15NO2/c1-3-5-8(4-2)6-7-9;1-2-7(3-5-8)4-6-9/h9H,3-7H2,1-2H3;8-9H,2-6H2,1H3.
What are the key properties of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol?
2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol has a molecular weight of 264.41 g/mol, XLogP of 0.00, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-[ethyl(propyl)amino]ethanol is sourced from PubChem (CID 161297591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).