C13H30N2 — CID 88655813
N-ethyl-N,N',N'-tripropylethane-1,2-diamine (PubChem CID 88655813) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is N-ethyl-N,N',N'-tripropylethane-1,2-diamine.
| Compound Name | N-ethyl-N,N',N'-tripropylethane-1,2-diamine |
|---|---|
| PubChem CID | 88655813 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | N-ethyl-N,N',N'-tripropylethane-1,2-diamine |
| SMILES | CCCN(CC)CCN(CCC)CCC |
| InChI | InChI=1S/C13H30N2/c1-5-9-14(8-4)12-13-15(10-6-2)11-7-3/h5-13H2,1-4H3 |
| InChIKey | NLSDGKWVDFQMPL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |