About ethane;N-ethyl-N-propylpropan-1-amine;hexane
ethane;N-ethyl-N-propylpropan-1-amine;hexane (PubChem CID 167521099) has the molecular formula C16H39N
and a molecular weight of 245.49 g/mol. Its IUPAC name is ethane;N-ethyl-N-propylpropan-1-amine;hexane.
Molecular Properties
| Compound Name | ethane;N-ethyl-N-propylpropan-1-amine;hexane |
| PubChem CID | 167521099 |
| Molecular Formula | C16H39N |
| Molecular Weight | 245.49 g/mol |
| Exact Mass | 245.31 |
| IUPAC Name | ethane;N-ethyl-N-propylpropan-1-amine;hexane |
| SMILES | CC.CCCCCC.CCCN(CC)CCC |
| InChI | InChI=1S/C8H19N.C6H14.C2H6/c1-4-7-9(6-3)8-5-2;1-3-5-6-4-2;1-2/h4-8H2,1-3H3;3-6H2,1-2H3;1-2H3 |
| InChIKey | KVIUMLWLUKYUFT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethyl-N-propylpropan-1-amine;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N-propylpropan-1-amine;hexane?
The IUPAC name of ethane;N-ethyl-N-propylpropan-1-amine;hexane (CID 167521099) is ethane;N-ethyl-N-propylpropan-1-amine;hexane.
What is the SMILES notation for ethane;N-ethyl-N-propylpropan-1-amine;hexane?
The canonical SMILES for ethane;N-ethyl-N-propylpropan-1-amine;hexane is CC.CCCCCC.CCCN(CC)CCC.
What is the InChIKey of ethane;N-ethyl-N-propylpropan-1-amine;hexane?
The InChIKey is KVIUMLWLUKYUFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C6H14.C2H6/c1-4-7-9(6-3)8-5-2;1-3-5-6-4-2;1-2/h4-8H2,1-3H3;3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;N-ethyl-N-propylpropan-1-amine;hexane?
ethane;N-ethyl-N-propylpropan-1-amine;hexane has a molecular weight of 245.49 g/mol, XLogP of 5.74, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N-propylpropan-1-amine;hexane is sourced from PubChem (CID 167521099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).