C15H36N2 — CID 160933502
N,N-diethylbutan-1-amine;N,N-diethylpropan-1-amine (PubChem CID 160933502) has the molecular formula C15H36N2 and a molecular weight of 244.47 g/mol. Its IUPAC name is N,N-diethylbutan-1-amine;N,N-diethylpropan-1-amine.
| Compound Name | N,N-diethylbutan-1-amine;N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 160933502 |
| Molecular Formula | C15H36N2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.29 |
| IUPAC Name | N,N-diethylbutan-1-amine;N,N-diethylpropan-1-amine |
| SMILES | CCCCN(CC)CC.CCCN(CC)CC |
| InChI | InChI=1S/C8H19N.C7H17N/c1-4-7-8-9(5-2)6-3;1-4-7-8(5-2)6-3/h4-8H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | STONIWCECZLFSN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |