About N-ethyl-N-propylbutan-1-amine;pentane
N-ethyl-N-propylbutan-1-amine;pentane (PubChem CID 143329949) has the molecular formula C14H33N
and a molecular weight of 215.42 g/mol. Its IUPAC name is N-ethyl-N-propylbutan-1-amine;pentane.
Molecular Properties
| Compound Name | N-ethyl-N-propylbutan-1-amine;pentane |
| PubChem CID | 143329949 |
| Molecular Formula | C14H33N |
| Molecular Weight | 215.42 g/mol |
| Exact Mass | 215.26 |
| IUPAC Name | N-ethyl-N-propylbutan-1-amine;pentane |
| SMILES | CCCCC.CCCCN(CC)CCC |
| InChI | InChI=1S/C9H21N.C5H12/c1-4-7-9-10(6-3)8-5-2;1-3-5-4-2/h4-9H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | FUGHLUVHGKKZIL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-N-propylbutan-1-amine;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propylbutan-1-amine;pentane?
The IUPAC name of N-ethyl-N-propylbutan-1-amine;pentane (CID 143329949) is N-ethyl-N-propylbutan-1-amine;pentane.
What is the SMILES notation for N-ethyl-N-propylbutan-1-amine;pentane?
The canonical SMILES for N-ethyl-N-propylbutan-1-amine;pentane is CCCCC.CCCCN(CC)CCC.
What is the InChIKey of N-ethyl-N-propylbutan-1-amine;pentane?
The InChIKey is FUGHLUVHGKKZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C5H12/c1-4-7-9-10(6-3)8-5-2;1-3-5-4-2/h4-9H2,1-3H3;3-5H2,1-2H3.
What are the key properties of N-ethyl-N-propylbutan-1-amine;pentane?
N-ethyl-N-propylbutan-1-amine;pentane has a molecular weight of 215.42 g/mol, XLogP of 4.71, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propylbutan-1-amine;pentane is sourced from PubChem (CID 143329949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).