C10H24FN — CID 19783533
N,N-dipropylbutan-1-amine;hydrofluoride (PubChem CID 19783533) has the molecular formula C10H24FN and a molecular weight of 177.31 g/mol. Its IUPAC name is N,N-dipropylbutan-1-amine;hydrofluoride.
| Compound Name | N,N-dipropylbutan-1-amine;hydrofluoride |
|---|---|
| PubChem CID | 19783533 |
| Molecular Formula | C10H24FN |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.19 |
| IUPAC Name | N,N-dipropylbutan-1-amine;hydrofluoride |
| SMILES | CCCCN(CCC)CCC.F |
| InChI | InChI=1S/C10H23N.FH/c1-4-7-10-11(8-5-2)9-6-3;/h4-10H2,1-3H3;1H |
| InChIKey | GZVQOUTWANLMPV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |