About N,N-dibutylbutan-1-amine;tetrahydrate
N,N-dibutylbutan-1-amine;tetrahydrate (PubChem CID 172865997) has the molecular formula C12H35NO4
and a molecular weight of 257.41 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;tetrahydrate.
Molecular Properties
| Compound Name | N,N-dibutylbutan-1-amine;tetrahydrate |
| PubChem CID | 172865997 |
| Molecular Formula | C12H35NO4 |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.26 |
| IUPAC Name | N,N-dibutylbutan-1-amine;tetrahydrate |
| SMILES | CCCCN(CCCC)CCCC.O.O.O.O |
| InChI | InChI=1S/C12H27N.4H2O/c1-4-7-10-13(11-8-5-2)12-9-6-3;;;;/h4-12H2,1-3H3;4*1H2 |
| InChIKey | ZZRARLSEUKUVIQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 129.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dibutylbutan-1-amine;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylbutan-1-amine;tetrahydrate?
The IUPAC name of N,N-dibutylbutan-1-amine;tetrahydrate (CID 172865997) is N,N-dibutylbutan-1-amine;tetrahydrate.
What is the SMILES notation for N,N-dibutylbutan-1-amine;tetrahydrate?
The canonical SMILES for N,N-dibutylbutan-1-amine;tetrahydrate is CCCCN(CCCC)CCCC.O.O.O.O.
What is the InChIKey of N,N-dibutylbutan-1-amine;tetrahydrate?
The InChIKey is ZZRARLSEUKUVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.4H2O/c1-4-7-10-13(11-8-5-2)12-9-6-3;;;;/h4-12H2,1-3H3;4*1H2.
What are the key properties of N,N-dibutylbutan-1-amine;tetrahydrate?
N,N-dibutylbutan-1-amine;tetrahydrate has a molecular weight of 257.41 g/mol, XLogP of 0.39, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylbutan-1-amine;tetrahydrate is sourced from PubChem (CID 172865997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).