About bromomethane;N,N-dibutylbutan-1-amine
bromomethane;N,N-dibutylbutan-1-amine (PubChem CID 87916924) has the molecular formula C13H30BrN
and a molecular weight of 280.29 g/mol. Its IUPAC name is bromomethane;N,N-dibutylbutan-1-amine.
Molecular Properties
| Compound Name | bromomethane;N,N-dibutylbutan-1-amine |
| PubChem CID | 87916924 |
| Molecular Formula | C13H30BrN |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | bromomethane;N,N-dibutylbutan-1-amine |
| SMILES | CBr.CCCCN(CCCC)CCCC |
| InChI | InChI=1S/C12H27N.CH3Br/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2/h4-12H2,1-3H3;1H3 |
| InChIKey | HOJZUMGLTMHJPZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;N,N-dibutylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;N,N-dibutylbutan-1-amine?
The IUPAC name of bromomethane;N,N-dibutylbutan-1-amine (CID 87916924) is bromomethane;N,N-dibutylbutan-1-amine.
What is the SMILES notation for bromomethane;N,N-dibutylbutan-1-amine?
The canonical SMILES for bromomethane;N,N-dibutylbutan-1-amine is CBr.CCCCN(CCCC)CCCC.
What is the InChIKey of bromomethane;N,N-dibutylbutan-1-amine?
The InChIKey is HOJZUMGLTMHJPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.CH3Br/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2/h4-12H2,1-3H3;1H3.
What are the key properties of bromomethane;N,N-dibutylbutan-1-amine?
bromomethane;N,N-dibutylbutan-1-amine has a molecular weight of 280.29 g/mol, XLogP of 4.70, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;N,N-dibutylbutan-1-amine is sourced from PubChem (CID 87916924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).