C14H32N2 — CID 91548124
N',N'-dibutyl-N,N-diethylethane-1,2-diamine (PubChem CID 91548124) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is N',N'-dibutyl-N,N-diethylethane-1,2-diamine.
| Compound Name | N',N'-dibutyl-N,N-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 91548124 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | N',N'-dibutyl-N,N-diethylethane-1,2-diamine |
| SMILES | CCCCN(CCCC)CCN(CC)CC |
| InChI | InChI=1S/C14H32N2/c1-5-9-11-16(12-10-6-2)14-13-15(7-3)8-4/h5-14H2,1-4H3 |
| InChIKey | ZBYISUXJWNMPBU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |