About N,N-dibutylbutan-1-amine;hydrogen peroxide
N,N-dibutylbutan-1-amine;hydrogen peroxide (PubChem CID 87070191) has the molecular formula C12H29NO2
and a molecular weight of 219.37 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;hydrogen peroxide.
Molecular Properties
| Compound Name | N,N-dibutylbutan-1-amine;hydrogen peroxide |
| PubChem CID | 87070191 |
| Molecular Formula | C12H29NO2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.22 |
| IUPAC Name | N,N-dibutylbutan-1-amine;hydrogen peroxide |
| SMILES | CCCCN(CCCC)CCCC.OO |
| InChI | InChI=1S/C12H27N.H2O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2/h4-12H2,1-3H3;1-2H |
| InChIKey | AMJQGYXUNBZNSH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutylbutan-1-amine;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylbutan-1-amine;hydrogen peroxide?
The IUPAC name of N,N-dibutylbutan-1-amine;hydrogen peroxide (CID 87070191) is N,N-dibutylbutan-1-amine;hydrogen peroxide.
What is the SMILES notation for N,N-dibutylbutan-1-amine;hydrogen peroxide?
The canonical SMILES for N,N-dibutylbutan-1-amine;hydrogen peroxide is CCCCN(CCCC)CCCC.OO.
What is the InChIKey of N,N-dibutylbutan-1-amine;hydrogen peroxide?
The InChIKey is AMJQGYXUNBZNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.H2O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2/h4-12H2,1-3H3;1-2H.
What are the key properties of N,N-dibutylbutan-1-amine;hydrogen peroxide?
N,N-dibutylbutan-1-amine;hydrogen peroxide has a molecular weight of 219.37 g/mol, XLogP of 3.71, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylbutan-1-amine;hydrogen peroxide is sourced from PubChem (CID 87070191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).