About N,N-dipentylpentan-1-amine;hydrate
N,N-dipentylpentan-1-amine;hydrate (PubChem CID 156801056) has the molecular formula C15H35NO
and a molecular weight of 245.45 g/mol. Its IUPAC name is N,N-dipentylpentan-1-amine;hydrate.
Molecular Properties
| Compound Name | N,N-dipentylpentan-1-amine;hydrate |
| PubChem CID | 156801056 |
| Molecular Formula | C15H35NO |
| Molecular Weight | 245.45 g/mol |
| Exact Mass | 245.27 |
| IUPAC Name | N,N-dipentylpentan-1-amine;hydrate |
| SMILES | CCCCCN(CCCCC)CCCCC.O |
| InChI | InChI=1S/C15H33N.H2O/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3;/h4-15H2,1-3H3;1H2 |
| InChIKey | OZIDPNYWVOEOIM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dipentylpentan-1-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipentylpentan-1-amine;hydrate?
The IUPAC name of N,N-dipentylpentan-1-amine;hydrate (CID 156801056) is N,N-dipentylpentan-1-amine;hydrate.
What is the SMILES notation for N,N-dipentylpentan-1-amine;hydrate?
The canonical SMILES for N,N-dipentylpentan-1-amine;hydrate is CCCCCN(CCCCC)CCCCC.O.
What is the InChIKey of N,N-dipentylpentan-1-amine;hydrate?
The InChIKey is OZIDPNYWVOEOIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N.H2O/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3;/h4-15H2,1-3H3;1H2.
What are the key properties of N,N-dipentylpentan-1-amine;hydrate?
N,N-dipentylpentan-1-amine;hydrate has a molecular weight of 245.45 g/mol, XLogP of 4.03, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipentylpentan-1-amine;hydrate is sourced from PubChem (CID 156801056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).