About N,N-dihexyloctan-1-amine
N,N-dihexyloctan-1-amine (PubChem CID 21418080) has the molecular formula C20H43N
and a molecular weight of 297.57 g/mol. Its IUPAC name is N,N-dihexyloctan-1-amine.
Molecular Properties
| Compound Name | N,N-dihexyloctan-1-amine |
| PubChem CID | 21418080 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | N,N-dihexyloctan-1-amine |
| SMILES | CCCCCCCCN(CCCCCC)CCCCCC |
| InChI | InChI=1S/C20H43N/c1-4-7-10-13-14-17-20-21(18-15-11-8-5-2)19-16-12-9-6-3/h4-20H2,1-3H3 |
| InChIKey | JORVYIAPZYMYSJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihexyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihexyloctan-1-amine?
The IUPAC name of N,N-dihexyloctan-1-amine (CID 21418080) is N,N-dihexyloctan-1-amine.
What is the SMILES notation for N,N-dihexyloctan-1-amine?
The canonical SMILES for N,N-dihexyloctan-1-amine is CCCCCCCCN(CCCCCC)CCCCCC.
What is the InChIKey of N,N-dihexyloctan-1-amine?
The InChIKey is JORVYIAPZYMYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43N/c1-4-7-10-13-14-17-20-21(18-15-11-8-5-2)19-16-12-9-6-3/h4-20H2,1-3H3.
What are the key properties of N,N-dihexyloctan-1-amine?
N,N-dihexyloctan-1-amine has a molecular weight of 297.57 g/mol, XLogP of 6.81, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihexyloctan-1-amine is sourced from PubChem (CID 21418080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).