About N,N-dioctyloctan-1-amine;silane
N,N-dioctyloctan-1-amine;silane (PubChem CID 174796791) has the molecular formula C24H55NSi
and a molecular weight of 385.80 g/mol. Its IUPAC name is N,N-dioctyloctan-1-amine;silane.
Molecular Properties
| Compound Name | N,N-dioctyloctan-1-amine;silane |
| PubChem CID | 174796791 |
| Molecular Formula | C24H55NSi |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.41 |
| IUPAC Name | N,N-dioctyloctan-1-amine;silane |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.[SiH4] |
| InChI | InChI=1S/C24H51N.H4Si/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h4-24H2,1-3H3;1H4 |
| InChIKey | MRPOWJZQKBUIQV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dioctyloctan-1-amine;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dioctyloctan-1-amine;silane?
The IUPAC name of N,N-dioctyloctan-1-amine;silane (CID 174796791) is N,N-dioctyloctan-1-amine;silane.
What is the SMILES notation for N,N-dioctyloctan-1-amine;silane?
The canonical SMILES for N,N-dioctyloctan-1-amine;silane is CCCCCCCCN(CCCCCCCC)CCCCCCCC.[SiH4].
What is the InChIKey of N,N-dioctyloctan-1-amine;silane?
The InChIKey is MRPOWJZQKBUIQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51N.H4Si/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h4-24H2,1-3H3;1H4.
What are the key properties of N,N-dioctyloctan-1-amine;silane?
N,N-dioctyloctan-1-amine;silane has a molecular weight of 385.80 g/mol, XLogP of 6.92, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dioctyloctan-1-amine;silane is sourced from PubChem (CID 174796791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).