C9H22N2 — CID 16768199
N'-butyl-N'-ethylpropane-1,3-diamine (PubChem CID 16768199) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is N'-butyl-N'-ethylpropane-1,3-diamine.
| Compound Name | N'-butyl-N'-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 16768199 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | N'-butyl-N'-ethylpropane-1,3-diamine |
| SMILES | CCCCN(CC)CCCN |
| InChI | InChI=1S/C9H22N2/c1-3-5-8-11(4-2)9-6-7-10/h3-10H2,1-2H3 |
| InChIKey | SMIQOXAFNYRXHC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |