C9H23N3 — CID 86127606
N'-(3-aminopropyl)-N'-ethylbutane-1,4-diamine (PubChem CID 86127606) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-ethylbutane-1,4-diamine.
| Compound Name | N'-(3-aminopropyl)-N'-ethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 86127606 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N'-(3-aminopropyl)-N'-ethylbutane-1,4-diamine |
| SMILES | CCN(CCCN)CCCCN |
| InChI | InChI=1S/C9H23N3/c1-2-12(9-5-7-11)8-4-3-6-10/h2-11H2,1H3 |
| InChIKey | ZVBQKUVIFJDEHB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|