C13H31N3 — CID 10955355
N'-(3-aminopropyl)-N'-hexylbutane-1,4-diamine (PubChem CID 10955355) has the molecular formula C13H31N3 and a molecular weight of 229.41 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-hexylbutane-1,4-diamine.
| Compound Name | N'-(3-aminopropyl)-N'-hexylbutane-1,4-diamine |
|---|---|
| PubChem CID | 10955355 |
| Molecular Formula | C13H31N3 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.25 |
| IUPAC Name | N'-(3-aminopropyl)-N'-hexylbutane-1,4-diamine |
| SMILES | CCCCCCN(CCCN)CCCCN |
| InChI | InChI=1S/C13H31N3/c1-2-3-4-6-11-16(13-8-10-15)12-7-5-9-14/h2-15H2,1H3 |
| InChIKey | BTYMIDOZIKWFHZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|