C13H32N2 — CID 170746351
N',N'-dibutylpropane-1,3-diamine;ethane (PubChem CID 170746351) has the molecular formula C13H32N2 and a molecular weight of 216.41 g/mol. Its IUPAC name is N',N'-dibutylpropane-1,3-diamine;ethane.
| Compound Name | N',N'-dibutylpropane-1,3-diamine;ethane |
|---|---|
| PubChem CID | 170746351 |
| Molecular Formula | C13H32N2 |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.26 |
| IUPAC Name | N',N'-dibutylpropane-1,3-diamine;ethane |
| SMILES | CC.CCCCN(CCCC)CCCN |
| InChI | InChI=1S/C11H26N2.C2H6/c1-3-5-9-13(10-6-4-2)11-7-8-12;1-2/h3-12H2,1-2H3;1-2H3 |
| InChIKey | LQYOLUAVWHEQFB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |