C24H57N3 — CID 160890057
butan-1-amine;N-butylbutan-1-amine;N,N-dibutylbutan-1-amine (PubChem CID 160890057) has the molecular formula C24H57N3 and a molecular weight of 387.74 g/mol. Its IUPAC name is butan-1-amine;N-butylbutan-1-amine;N,N-dibutylbutan-1-amine.
| Compound Name | butan-1-amine;N-butylbutan-1-amine;N,N-dibutylbutan-1-amine |
|---|---|
| PubChem CID | 160890057 |
| Molecular Formula | C24H57N3 |
| Molecular Weight | 387.74 g/mol |
| Exact Mass | 387.46 |
| IUPAC Name | butan-1-amine;N-butylbutan-1-amine;N,N-dibutylbutan-1-amine |
| SMILES | CCCCN.CCCCN(CCCC)CCCC.CCCCNCCCC |
| InChI | InChI=1S/C12H27N.C8H19N.C4H11N/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3-5-7-9-8-6-4-2;1-2-3-4-5/h4-12H2,1-3H3;9H,3-8H2,1-2H3;2-5H2,1H3 |
| InChIKey | SODLSQVIHWYDHQ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|