C28H64N4 — CID 19864694
N'-(2-aminoethyl)ethane-1,2-diamine;N,N-dioctyloctan-1-amine (PubChem CID 19864694) has the molecular formula C28H64N4 and a molecular weight of 456.85 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;N,N-dioctyloctan-1-amine.
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;N,N-dioctyloctan-1-amine |
|---|---|
| PubChem CID | 19864694 |
| Molecular Formula | C28H64N4 |
| Molecular Weight | 456.85 g/mol |
| Exact Mass | 456.51 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;N,N-dioctyloctan-1-amine |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.NCCNCCN |
| InChI | InChI=1S/C24H51N.C4H13N3/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;5-1-3-7-4-2-6/h4-24H2,1-3H3;7H,1-6H2 |
| InChIKey | AXHNHYVNHQKLML-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.85 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|