C40H86N2 — CID 87111202
N,N-dioctyloctan-1-amine;N-octyloctan-1-amine (PubChem CID 87111202) has the molecular formula C40H86N2 and a molecular weight of 595.14 g/mol. Its IUPAC name is N,N-dioctyloctan-1-amine;N-octyloctan-1-amine.
| Compound Name | N,N-dioctyloctan-1-amine;N-octyloctan-1-amine |
|---|---|
| PubChem CID | 87111202 |
| Molecular Formula | C40H86N2 |
| Molecular Weight | 595.14 g/mol |
| Exact Mass | 594.68 |
| IUPAC Name | N,N-dioctyloctan-1-amine;N-octyloctan-1-amine |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.CCCCCCCCNCCCCCCCC |
| InChI | InChI=1S/C24H51N.C16H35N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2/h4-24H2,1-3H3;17H,3-16H2,1-2H3 |
| InChIKey | SAMQQVMYRCMRLJ-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.14 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|