C21H48N4 — CID 164800746
N'-(3-aminopropyl)-N'-[3-(dodecylamino)propyl]propane-1,3-diamine (PubChem CID 164800746) has the molecular formula C21H48N4 and a molecular weight of 356.64 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-[3-(dodecylamino)propyl]propane-1,3-diamine.
| Compound Name | N'-(3-aminopropyl)-N'-[3-(dodecylamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 164800746 |
| Molecular Formula | C21H48N4 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.39 |
| IUPAC Name | N'-(3-aminopropyl)-N'-[3-(dodecylamino)propyl]propane-1,3-diamine |
| SMILES | CCCCCCCCCCCCNCCCN(CCCN)CCCN |
| InChI | InChI=1S/C21H48N4/c1-2-3-4-5-6-7-8-9-10-11-17-24-18-14-21-25(19-12-15-22)20-13-16-23/h24H,2-23H2,1H3 |
| InChIKey | XRLSJVIQXPZGBX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|