C13H33N5 — CID 86175000
N,N',N'-tris(3-aminopropyl)butane-1,4-diamine (PubChem CID 86175000) has the molecular formula C13H33N5 and a molecular weight of 259.44 g/mol. Its IUPAC name is N,N',N'-tris(3-aminopropyl)butane-1,4-diamine.
| Compound Name | N,N',N'-tris(3-aminopropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 86175000 |
| Molecular Formula | C13H33N5 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.27 |
| IUPAC Name | N,N',N'-tris(3-aminopropyl)butane-1,4-diamine |
| SMILES | NCCCNCCCCN(CCCN)CCCN |
| InChI | InChI=1S/C13H33N5/c14-6-3-10-17-9-1-2-11-18(12-4-7-15)13-5-8-16/h17H,1-16H2 |
| InChIKey | UAGCUQRCYLGHHF-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|