C17H44N6 — CID 158129365
methane;N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine (PubChem CID 158129365) has the molecular formula C17H44N6 and a molecular weight of 332.58 g/mol. Its IUPAC name is methane;N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine.
| Compound Name | methane;N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 158129365 |
| Molecular Formula | C17H44N6 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.36 |
| IUPAC Name | methane;N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine |
| SMILES | C.NCCCN(CCCN)CCCCN(CCCN)CCCN |
| InChI | InChI=1S/C16H40N6.CH4/c17-7-3-13-21(14-4-8-18)11-1-2-12-22(15-5-9-19)16-6-10-20;/h1-20H2;1H4 |
| InChIKey | FSOSGKSMGAFGQL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|