C22H52N6 — CID 87383613
N,N,N',N'-tetrakis(3-aminopropyl)decane-1,10-diamine (PubChem CID 87383613) has the molecular formula C22H52N6 and a molecular weight of 400.70 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(3-aminopropyl)decane-1,10-diamine.
| Compound Name | N,N,N',N'-tetrakis(3-aminopropyl)decane-1,10-diamine |
|---|---|
| PubChem CID | 87383613 |
| Molecular Formula | C22H52N6 |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 400.43 |
| IUPAC Name | N,N,N',N'-tetrakis(3-aminopropyl)decane-1,10-diamine |
| SMILES | NCCCN(CCCN)CCCCCCCCCCN(CCCN)CCCN |
| InChI | InChI=1S/C22H52N6/c23-13-9-19-27(20-10-14-24)17-7-5-3-1-2-4-6-8-18-28(21-11-15-25)22-12-16-26/h1-26H2 |
| InChIKey | IVGCCEVCWCEGAS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|