C7H18Br4N2 — CID 170557636
N',N'-bis(2-bromoethyl)propane-1,3-diamine;dihydrobromide (PubChem CID 170557636) has the molecular formula C7H18Br4N2 and a molecular weight of 449.85 g/mol. Its IUPAC name is N',N'-bis(2-bromoethyl)propane-1,3-diamine;dihydrobromide.
| Compound Name | N',N'-bis(2-bromoethyl)propane-1,3-diamine;dihydrobromide |
|---|---|
| PubChem CID | 170557636 |
| Molecular Formula | C7H18Br4N2 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 445.82 |
| IUPAC Name | N',N'-bis(2-bromoethyl)propane-1,3-diamine;dihydrobromide |
| SMILES | Br.Br.NCCCN(CCBr)CCBr |
| InChI | InChI=1S/C7H16Br2N2.2BrH/c8-2-6-11(7-3-9)5-1-4-10;;/h1-7,10H2;2*1H |
| InChIKey | FUKPTUICKBIKKB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|