C12H24Br4N2 — CID 58300614
N,N,N',N'-tetrakis(2-bromoethyl)butane-1,4-diamine (PubChem CID 58300614) has the molecular formula C12H24Br4N2 and a molecular weight of 515.95 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2-bromoethyl)butane-1,4-diamine.
| Compound Name | N,N,N',N'-tetrakis(2-bromoethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 58300614 |
| Molecular Formula | C12H24Br4N2 |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 511.87 |
| IUPAC Name | N,N,N',N'-tetrakis(2-bromoethyl)butane-1,4-diamine |
| SMILES | BrCCN(CCBr)CCCCN(CCBr)CCBr |
| InChI | InChI=1S/C12H24Br4N2/c13-3-9-17(10-4-14)7-1-2-8-18(11-5-15)12-6-16/h1-12H2 |
| InChIKey | QDFWFCDWGPSJBN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|