C28H56I8N6 — CID 58300626
N,N,N',N'-tetrakis[2-[bis(2-iodoethyl)amino]ethyl]butane-1,4-diamine (PubChem CID 58300626) has the molecular formula C28H56I8N6 and a molecular weight of 1492.03 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[2-[bis(2-iodoethyl)amino]ethyl]butane-1,4-diamine.
| Compound Name | N,N,N',N'-tetrakis[2-[bis(2-iodoethyl)amino]ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 58300626 |
| Molecular Formula | C28H56I8N6 |
| Molecular Weight | 1492.03 g/mol |
| Exact Mass | 1491.69 |
| IUPAC Name | N,N,N',N'-tetrakis[2-[bis(2-iodoethyl)amino]ethyl]butane-1,4-diamine |
| SMILES | ICCN(CCI)CCN(CCCCN(CCN(CCI)CCI)CCN(CCI)CCI)CCN(CCI)CCI |
| InChI | InChI=1S/C28H56I8N6/c29-3-13-39(14-4-30)25-21-37(22-26-40(15-5-31)16-6-32)11-1-2-12-38(23-27-41(17-7-33)18-8-34)24-28-42(19-9-35)20-10-36/h1-28H2 |
| InChIKey | GYIJHDULKPCAAR-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1492.03 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|