About N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine
N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine (PubChem CID 107487527) has the molecular formula C11H22BrF2N
and a molecular weight of 286.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine |
| PubChem CID | 107487527 |
| Molecular Formula | C11H22BrF2N |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine |
| SMILES | CCCCCCCN(CCBr)CC(F)F |
| InChI | InChI=1S/C11H22BrF2N/c1-2-3-4-5-6-8-15(9-7-12)10-11(13)14/h11H,2-10H2,1H3 |
| InChIKey | QOANBDZNIRRKCS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine?
The IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine (CID 107487527) is N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine.
What is the SMILES notation for N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine?
The canonical SMILES for N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine is CCCCCCCN(CCBr)CC(F)F.
What is the InChIKey of N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine?
The InChIKey is QOANBDZNIRRKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22BrF2N/c1-2-3-4-5-6-8-15(9-7-12)10-11(13)14/h11H,2-10H2,1H3.
What are the key properties of N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine?
N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine has a molecular weight of 286.20 g/mol, XLogP of 3.92, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-N-(2,2-difluoroethyl)heptan-1-amine is sourced from PubChem (CID 107487527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).