C13H34N6 — CID 162227177
N',N'-bis[2-(2-aminoethylamino)ethyl]pentane-1,5-diamine (PubChem CID 162227177) has the molecular formula C13H34N6 and a molecular weight of 274.46 g/mol. Its IUPAC name is N',N'-bis[2-(2-aminoethylamino)ethyl]pentane-1,5-diamine.
| Compound Name | N',N'-bis[2-(2-aminoethylamino)ethyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 162227177 |
| Molecular Formula | C13H34N6 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.28 |
| IUPAC Name | N',N'-bis[2-(2-aminoethylamino)ethyl]pentane-1,5-diamine |
| SMILES | NCCCCCN(CCNCCN)CCNCCN |
| InChI | InChI=1S/C13H34N6/c14-4-2-1-3-11-19(12-9-17-7-5-15)13-10-18-8-6-16/h17-18H,1-16H2 |
| InChIKey | NMGQRPFAYXPMHX-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|