C24H50N2 — CID 154402145
N,N-diethylicos-9-ene-1,20-diamine (PubChem CID 154402145) has the molecular formula C24H50N2 and a molecular weight of 366.68 g/mol. Its IUPAC name is N,N-diethylicos-9-ene-1,20-diamine.
| Compound Name | N,N-diethylicos-9-ene-1,20-diamine |
|---|---|
| PubChem CID | 154402145 |
| Molecular Formula | C24H50N2 |
| Molecular Weight | 366.68 g/mol |
| Exact Mass | 366.40 |
| IUPAC Name | N,N-diethylicos-9-ene-1,20-diamine |
| SMILES | CCN(CC)CCCCCCCCC=CCCCCCCCCCCN |
| InChI | InChI=1S/C24H50N2/c1-3-26(4-2)24-22-20-18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21-23-25/h6,8H,3-5,7,9-25H2,1-2H3 |
| InChIKey | BJGPUJNPYSLHJM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.68 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|